C11H17NO4 — CID 134966293
tert-butyl 2-[(4R,5R)-5-ethenyl-2-oxo-1,3-oxazolidin-4-yl]acetate (PubChem CID 134966293) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is tert-butyl 2-[(4R,5R)-5-ethenyl-2-oxo-1,3-oxazolidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4R,5R)-5-ethenyl-2-oxo-1,3-oxazolidin-4-yl]acetate |
|---|---|
| PubChem CID | 134966293 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | tert-butyl 2-[(4R,5R)-5-ethenyl-2-oxo-1,3-oxazolidin-4-yl]acetate |
| SMILES | C=C[C@H]1OC(=O)N[C@@H]1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H17NO4/c1-5-8-7(12-10(14)15-8)6-9(13)16-11(2,3)4/h5,7-8H,1,6H2,2-4H3,(H,12,14)/t7-,8-/m1/s1 |
| InChIKey | SUOCJQPESGWNPS-HTQZYQBOSA-N |
| XLogP | 1.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|