C8H18N4 — CID 22957306
N,N,N'-trimethylpiperazine-1-carboximidamide (PubChem CID 22957306) has the molecular formula C8H18N4 and a molecular weight of 170.26 g/mol. Its IUPAC name is N,N,N'-trimethylpiperazine-1-carboximidamide.
| Compound Name | N,N,N'-trimethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 22957306 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | N,N,N'-trimethylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\N(C)C)N1CCNCC1 |
| InChI | InChI=1S/C8H18N4/c1-9-8(11(2)3)12-6-4-10-5-7-12/h10H,4-7H2,1-3H3/b9-8+ |
| InChIKey | XVRIDEZWMASKDG-CMDGGOBGSA-N |
| XLogP | -0.56 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|