C13H34OSi3 — CID 22957531
[3-[dimethyl(trimethylsilyloxy)silyl]-2,2-dimethylpropyl]-trimethylsilane (PubChem CID 22957531) has the molecular formula C13H34OSi3 and a molecular weight of 290.67 g/mol. Its IUPAC name is [3-[dimethyl(trimethylsilyloxy)silyl]-2,2-dimethylpropyl]-trimethylsilane.
| Compound Name | [3-[dimethyl(trimethylsilyloxy)silyl]-2,2-dimethylpropyl]-trimethylsilane |
|---|---|
| PubChem CID | 22957531 |
| Molecular Formula | C13H34OSi3 |
| Molecular Weight | 290.67 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [3-[dimethyl(trimethylsilyloxy)silyl]-2,2-dimethylpropyl]-trimethylsilane |
| SMILES | CC(C)(C[Si](C)(C)C)C[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H34OSi3/c1-13(2,11-15(3,4)5)12-17(9,10)14-16(6,7)8/h11-12H2,1-10H3 |
| InChIKey | MSKUOCBBNAOMMD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|