C14H36OSi4 — CID 10958542
[1-bis(trimethylsilyl)silylidene-2,2-dimethylpropoxy]-trimethylsilane (PubChem CID 10958542) has the molecular formula C14H36OSi4 and a molecular weight of 332.79 g/mol. Its IUPAC name is [1-bis(trimethylsilyl)silylidene-2,2-dimethylpropoxy]-trimethylsilane.
| Compound Name | [1-bis(trimethylsilyl)silylidene-2,2-dimethylpropoxy]-trimethylsilane |
|---|---|
| PubChem CID | 10958542 |
| Molecular Formula | C14H36OSi4 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | [1-bis(trimethylsilyl)silylidene-2,2-dimethylpropoxy]-trimethylsilane |
| SMILES | CC(C)(C)C(O[Si](C)(C)C)=[Si]([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H36OSi4/c1-14(2,3)13(15-17(4,5)6)16(18(7,8)9)19(10,11)12/h1-12H3 |
| InChIKey | IDCZULGOUHKDMG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|