C20H42OSi2 — CID 134919365
tributyl-[2-[tert-butyl(dimethyl)silyl]ethynoxy]silane (PubChem CID 134919365) has the molecular formula C20H42OSi2 and a molecular weight of 354.73 g/mol. Its IUPAC name is tributyl-[2-[tert-butyl(dimethyl)silyl]ethynoxy]silane.
| Compound Name | tributyl-[2-[tert-butyl(dimethyl)silyl]ethynoxy]silane |
|---|---|
| PubChem CID | 134919365 |
| Molecular Formula | C20H42OSi2 |
| Molecular Weight | 354.73 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | tributyl-[2-[tert-butyl(dimethyl)silyl]ethynoxy]silane |
| SMILES | CCCC[Si](CCCC)(CCCC)OC#C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42OSi2/c1-9-12-16-23(17-13-10-2,18-14-11-3)21-15-19-22(7,8)20(4,5)6/h9-14,16-18H2,1-8H3 |
| InChIKey | MBRQSPCAZUDOKX-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.73 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|