C16H34OSi2 — CID 10685506
tert-butyl-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyethynyl]-dimethylsilane (PubChem CID 10685506) has the molecular formula C16H34OSi2 and a molecular weight of 298.62 g/mol. Its IUPAC name is tert-butyl-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyethynyl]-dimethylsilane.
| Compound Name | tert-butyl-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyethynyl]-dimethylsilane |
|---|---|
| PubChem CID | 10685506 |
| Molecular Formula | C16H34OSi2 |
| Molecular Weight | 298.62 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | tert-butyl-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyethynyl]-dimethylsilane |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OC#C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34OSi2/c1-14(2)16(6,7)19(10,11)17-12-13-18(8,9)15(3,4)5/h14H,1-11H3 |
| InChIKey | ZVIWULOSMWSHQE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.62 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|