C17H36OSi2 — CID 134919760
tert-butyl-dimethyl-(2-tripropylsilyloxyethynyl)silane (PubChem CID 134919760) has the molecular formula C17H36OSi2 and a molecular weight of 312.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2-tripropylsilyloxyethynyl)silane.
| Compound Name | tert-butyl-dimethyl-(2-tripropylsilyloxyethynyl)silane |
|---|---|
| PubChem CID | 134919760 |
| Molecular Formula | C17H36OSi2 |
| Molecular Weight | 312.65 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | tert-butyl-dimethyl-(2-tripropylsilyloxyethynyl)silane |
| SMILES | CCC[Si](CCC)(CCC)OC#C[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36OSi2/c1-9-13-20(14-10-2,15-11-3)18-12-16-19(7,8)17(4,5)6/h9-11,13-15H2,1-8H3 |
| InChIKey | LCQCKIFRWHOGFV-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|