C13H34OSi3 — CID 12547101
trimethyl-[2-methyl-1,1-bis(trimethylsilyl)propoxy]silane (PubChem CID 12547101) has the molecular formula C13H34OSi3 and a molecular weight of 290.67 g/mol. Its IUPAC name is trimethyl-[2-methyl-1,1-bis(trimethylsilyl)propoxy]silane.
| Compound Name | trimethyl-[2-methyl-1,1-bis(trimethylsilyl)propoxy]silane |
|---|---|
| PubChem CID | 12547101 |
| Molecular Formula | C13H34OSi3 |
| Molecular Weight | 290.67 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | trimethyl-[2-methyl-1,1-bis(trimethylsilyl)propoxy]silane |
| SMILES | CC(C)C(O[Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H34OSi3/c1-12(2)13(15(3,4)5,16(6,7)8)14-17(9,10)11/h12H,1-11H3 |
| InChIKey | VURCGZSGGPAQSQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|