C10H26OSi2 — CID 554729
2,2-dimethylpropoxy-dimethyl-trimethylsilylsilane (PubChem CID 554729) has the molecular formula C10H26OSi2 and a molecular weight of 218.49 g/mol. Its IUPAC name is 2,2-dimethylpropoxy-dimethyl-trimethylsilylsilane.
| Compound Name | 2,2-dimethylpropoxy-dimethyl-trimethylsilylsilane |
|---|---|
| PubChem CID | 554729 |
| Molecular Formula | C10H26OSi2 |
| Molecular Weight | 218.49 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2,2-dimethylpropoxy-dimethyl-trimethylsilylsilane |
| SMILES | CC(C)(C)CO[Si](C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C10H26OSi2/c1-10(2,3)9-11-13(7,8)12(4,5)6/h9H2,1-8H3 |
| InChIKey | IXDRUBVDUUDOMH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|