C14H34OSi3 — CID 14115328
2,2-dimethyl-1-[propan-2-yl-bis(trimethylsilyl)silyl]propan-1-one (PubChem CID 14115328) has the molecular formula C14H34OSi3 and a molecular weight of 302.68 g/mol. Its IUPAC name is 2,2-dimethyl-1-[propan-2-yl-bis(trimethylsilyl)silyl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[propan-2-yl-bis(trimethylsilyl)silyl]propan-1-one |
|---|---|
| PubChem CID | 14115328 |
| Molecular Formula | C14H34OSi3 |
| Molecular Weight | 302.68 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2,2-dimethyl-1-[propan-2-yl-bis(trimethylsilyl)silyl]propan-1-one |
| SMILES | CC(C)[Si](C(=O)C(C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H34OSi3/c1-12(2)18(16(6,7)8,17(9,10)11)13(15)14(3,4)5/h12H,1-11H3 |
| InChIKey | YIFQMRGQDOTIMN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|