C12H30OSi3 — CID 14115329
2,2-dimethyl-1-[methyl-bis(trimethylsilyl)silyl]propan-1-one (PubChem CID 14115329) has the molecular formula C12H30OSi3 and a molecular weight of 274.63 g/mol. Its IUPAC name is 2,2-dimethyl-1-[methyl-bis(trimethylsilyl)silyl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[methyl-bis(trimethylsilyl)silyl]propan-1-one |
|---|---|
| PubChem CID | 14115329 |
| Molecular Formula | C12H30OSi3 |
| Molecular Weight | 274.63 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2,2-dimethyl-1-[methyl-bis(trimethylsilyl)silyl]propan-1-one |
| SMILES | CC(C)(C)C(=O)[Si](C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H30OSi3/c1-12(2,3)11(13)16(10,14(4,5)6)15(7,8)9/h1-10H3 |
| InChIKey | UIWMBFJOXJBFAR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|