C11H24OSi — CID 86209855
2,2-dimethyl-1-triethylsilylpropan-1-one (PubChem CID 86209855) has the molecular formula C11H24OSi and a molecular weight of 200.40 g/mol. Its IUPAC name is 2,2-dimethyl-1-triethylsilylpropan-1-one.
| Compound Name | 2,2-dimethyl-1-triethylsilylpropan-1-one |
|---|---|
| PubChem CID | 86209855 |
| Molecular Formula | C11H24OSi |
| Molecular Weight | 200.40 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2,2-dimethyl-1-triethylsilylpropan-1-one |
| SMILES | CC[Si](CC)(CC)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H24OSi/c1-7-13(8-2,9-3)10(12)11(4,5)6/h7-9H2,1-6H3 |
| InChIKey | HJDXHPAOGDMHGQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|