C10H23AsOSi — CID 12633103
1-[ethyl(trimethylsilyl)arsanyl]-2,2-dimethylpropan-1-one (PubChem CID 12633103) has the molecular formula C10H23AsOSi and a molecular weight of 262.30 g/mol. Its IUPAC name is 1-[ethyl(trimethylsilyl)arsanyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[ethyl(trimethylsilyl)arsanyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 12633103 |
| Molecular Formula | C10H23AsOSi |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 1-[ethyl(trimethylsilyl)arsanyl]-2,2-dimethylpropan-1-one |
| SMILES | CC[As](C(=O)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C10H23AsOSi/c1-8-11(13(5,6)7)9(12)10(2,3)4/h8H2,1-7H3 |
| InChIKey | WHGPWOBLZBMESV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|