C11H25AsOSi — CID 12633104
2,2-dimethyl-1-[propan-2-yl(trimethylsilyl)arsanyl]propan-1-one (PubChem CID 12633104) has the molecular formula C11H25AsOSi and a molecular weight of 276.33 g/mol. Its IUPAC name is 2,2-dimethyl-1-[propan-2-yl(trimethylsilyl)arsanyl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[propan-2-yl(trimethylsilyl)arsanyl]propan-1-one |
|---|---|
| PubChem CID | 12633104 |
| Molecular Formula | C11H25AsOSi |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2,2-dimethyl-1-[propan-2-yl(trimethylsilyl)arsanyl]propan-1-one |
| SMILES | CC(C)[As](C(=O)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C11H25AsOSi/c1-9(2)12(14(6,7)8)10(13)11(3,4)5/h9H,1-8H3 |
| InChIKey | JWYKJOITEMXZRX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|