C12H27AsOSi — CID 12633105
1-[tert-butyl(trimethylsilyl)arsanyl]-2,2-dimethylpropan-1-one (PubChem CID 12633105) has the molecular formula C12H27AsOSi and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-[tert-butyl(trimethylsilyl)arsanyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[tert-butyl(trimethylsilyl)arsanyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 12633105 |
| Molecular Formula | C12H27AsOSi |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[tert-butyl(trimethylsilyl)arsanyl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[As](C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H27AsOSi/c1-11(2,3)10(14)13(12(4,5)6)15(7,8)9/h1-9H3 |
| InChIKey | XKOSTMYAINXHSH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|