C11H27OPSi2 — CID 23414910
1-bis(trimethylsilyl)phosphanyl-2,2-dimethylpropan-1-one (PubChem CID 23414910) has the molecular formula C11H27OPSi2 and a molecular weight of 262.48 g/mol. Its IUPAC name is 1-bis(trimethylsilyl)phosphanyl-2,2-dimethylpropan-1-one.
| Compound Name | 1-bis(trimethylsilyl)phosphanyl-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 23414910 |
| Molecular Formula | C11H27OPSi2 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-bis(trimethylsilyl)phosphanyl-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)P([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C11H27OPSi2/c1-11(2,3)10(12)13(14(4,5)6)15(7,8)9/h1-9H3 |
| InChIKey | MBZUHZISQCETPN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|