C27H35N5O3S — CID 22958780
N-[2-(3-benzylimidazol-4-yl)ethyl]-1-methylsulfinyl-4-(2-phenylmethoxyethyl)piperazine-2-carboxamide (PubChem CID 22958780) has the molecular formula C27H35N5O3S and a molecular weight of 509.68 g/mol. Its IUPAC name is N-[2-(3-benzylimidazol-4-yl)ethyl]-1-methylsulfinyl-4-(2-phenylmethoxyethyl)piperazine-2-carboxamide.
| Compound Name | N-[2-(3-benzylimidazol-4-yl)ethyl]-1-methylsulfinyl-4-(2-phenylmethoxyethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 22958780 |
| Molecular Formula | C27H35N5O3S |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | N-[2-(3-benzylimidazol-4-yl)ethyl]-1-methylsulfinyl-4-(2-phenylmethoxyethyl)piperazine-2-carboxamide |
| SMILES | CS(=O)N1CCN(CCOCc2ccccc2)CC1C(=O)NCCc1cncn1Cc1ccccc1 |
| InChI | InChI=1S/C27H35N5O3S/c1-36(34)32-15-14-30(16-17-35-21-24-10-6-3-7-11-24)20-26(32)27(33)29-13-12-25-18-28-22-31(25)19-23-8-4-2-5-9-23/h2-11,18,22,26H,12-17,19-21H2,1H3,(H,29,33) |
| InChIKey | NHGRSLMLXSWCKO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|