C12H6Cl2FNO — CID 22959838
4-(4,4-dichloro-3-oxobut-1-ynyl)-5-fluoro-2-methylbenzonitrile (PubChem CID 22959838) has the molecular formula C12H6Cl2FNO and a molecular weight of 270.09 g/mol. Its IUPAC name is 4-(4,4-dichloro-3-oxobut-1-ynyl)-5-fluoro-2-methylbenzonitrile.
| Compound Name | 4-(4,4-dichloro-3-oxobut-1-ynyl)-5-fluoro-2-methylbenzonitrile |
|---|---|
| PubChem CID | 22959838 |
| Molecular Formula | C12H6Cl2FNO |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 268.98 |
| IUPAC Name | 4-(4,4-dichloro-3-oxobut-1-ynyl)-5-fluoro-2-methylbenzonitrile |
| SMILES | Cc1cc(C#CC(=O)C(Cl)Cl)c(F)cc1C#N |
| InChI | InChI=1S/C12H6Cl2FNO/c1-7-4-8(2-3-11(17)12(13)14)10(15)5-9(7)6-16/h4-5,12H,1H3 |
| InChIKey | KFPNXLSIIBPOHL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|