C27H16N2O2S2+2 — CID 22960246
6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] (PubChem CID 22960246) has the molecular formula C27H16N2O2S2+2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium].
| Compound Name | 6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] |
|---|---|
| PubChem CID | 22960246 |
| Molecular Formula | C27H16N2O2S2+2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] |
| SMILES | c1ccc2c(c1)OC1(Oc3ccccc3-c3sc4ccccc4[n+]31)[n+]1c-2sc2ccccc21 |
| InChI | InChI=1S/C27H16N2O2S2/c1-5-13-21-17(9-1)25-28(19-11-3-7-15-23(19)32-25)27(30-21)29-20-12-4-8-16-24(20)33-26(29)18-10-2-6-14-22(18)31-27/h1-16H/q+2 |
| InChIKey | AVQJCGMBWXOKJH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|