C15H24OSi — CID 22962106
[(E)-10-ethoxydec-4-en-1,8-diynyl]-trimethylsilane (PubChem CID 22962106) has the molecular formula C15H24OSi and a molecular weight of 248.44 g/mol. Its IUPAC name is [(E)-10-ethoxydec-4-en-1,8-diynyl]-trimethylsilane.
| Compound Name | [(E)-10-ethoxydec-4-en-1,8-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 22962106 |
| Molecular Formula | C15H24OSi |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [(E)-10-ethoxydec-4-en-1,8-diynyl]-trimethylsilane |
| SMILES | CCOCC#CCC/C=C/CC#C[Si](C)(C)C |
| InChI | InChI=1S/C15H24OSi/c1-5-16-14-12-10-8-6-7-9-11-13-15-17(2,3)4/h7,9H,5-6,8,11,14H2,1-4H3/b9-7+ |
| InChIKey | RUYZAGQHHQROOI-VQHVLOKHSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|