C25H30F3NO4 — CID 22962473
(Z)-1-[3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butan-2-yloxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine (PubChem CID 22962473) has the molecular formula C25H30F3NO4 and a molecular weight of 465.51 g/mol. Its IUPAC name is (Z)-1-[3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butan-2-yloxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine.
| Compound Name | (Z)-1-[3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butan-2-yloxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine |
|---|---|
| PubChem CID | 22962473 |
| Molecular Formula | C25H30F3NO4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | (Z)-1-[3-[4-[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]butan-2-yloxy]phenyl]-2,2,2-trifluoro-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCCC(C)Oc2cccc(/C(=N/OC)C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C25H30F3NO4/c1-6-7-12-31-22-14-17(2)23(18(3)15-22)32-13-11-19(4)33-21-10-8-9-20(16-21)24(29-30-5)25(26,27)28/h6-10,14-16,19H,11-13H2,1-5H3/b7-6+,29-24- |
| InChIKey | YZLUAZRHMXJSKY-MYVLRCDPSA-N |
| XLogP | 6.41 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|