C23H29NO2S — CID 22962704
(E)-1-[4-[3-[4-[(E)-but-2-enyl]sulfanyl-2,6-dimethylphenoxy]propyl]phenyl]-N-methoxymethanimine (PubChem CID 22962704) has the molecular formula C23H29NO2S and a molecular weight of 383.56 g/mol. Its IUPAC name is (E)-1-[4-[3-[4-[(E)-but-2-enyl]sulfanyl-2,6-dimethylphenoxy]propyl]phenyl]-N-methoxymethanimine.
| Compound Name | (E)-1-[4-[3-[4-[(E)-but-2-enyl]sulfanyl-2,6-dimethylphenoxy]propyl]phenyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 22962704 |
| Molecular Formula | C23H29NO2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (E)-1-[4-[3-[4-[(E)-but-2-enyl]sulfanyl-2,6-dimethylphenoxy]propyl]phenyl]-N-methoxymethanimine |
| SMILES | C/C=C/CSc1cc(C)c(OCCCc2ccc(/C=N/OC)cc2)c(C)c1 |
| InChI | InChI=1S/C23H29NO2S/c1-5-6-14-27-22-15-18(2)23(19(3)16-22)26-13-7-8-20-9-11-21(12-10-20)17-24-25-4/h5-6,9-12,15-17H,7-8,13-14H2,1-4H3/b6-5+,24-17+ |
| InChIKey | BBSMDRIYSKWRAZ-ZVLYUEHQSA-N |
| XLogP | 5.96 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|