C21H25NO3S — CID 90718358
1-[4-[[4-[(E)-but-2-enyl]sulfanyl-2,6-dimethylphenoxy]methoxy]phenyl]-N-methoxymethanimine (PubChem CID 90718358) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is 1-[4-[[4-[(E)-but-2-enyl]sulfanyl-2,6-dimethylphenoxy]methoxy]phenyl]-N-methoxymethanimine.
| Compound Name | 1-[4-[[4-[(E)-but-2-enyl]sulfanyl-2,6-dimethylphenoxy]methoxy]phenyl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 90718358 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1-[4-[[4-[(E)-but-2-enyl]sulfanyl-2,6-dimethylphenoxy]methoxy]phenyl]-N-methoxymethanimine |
| SMILES | C/C=C/CSc1cc(C)c(OCOc2ccc(C=NOC)cc2)c(C)c1 |
| InChI | InChI=1S/C21H25NO3S/c1-5-6-11-26-20-12-16(2)21(17(3)13-20)25-15-24-19-9-7-18(8-10-19)14-22-23-4/h5-10,12-14H,11,15H2,1-4H3/b6-5+,22-14? |
| InChIKey | WFHVQSULAZHTTF-SMFUCZSBSA-N |
| XLogP | 5.37 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|