C19H24N2O3S — CID 22962809
(E)-1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-1,3-thiazol-2-yl]-N-methoxyethanimine (PubChem CID 22962809) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is (E)-1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-1,3-thiazol-2-yl]-N-methoxyethanimine.
| Compound Name | (E)-1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-1,3-thiazol-2-yl]-N-methoxyethanimine |
|---|---|
| PubChem CID | 22962809 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (E)-1-[4-[[4-[(E)-but-2-enoxy]-2,6-dimethylphenoxy]methyl]-1,3-thiazol-2-yl]-N-methoxyethanimine |
| SMILES | C/C=C/COc1cc(C)c(OCc2csc(/C(C)=N/OC)n2)c(C)c1 |
| InChI | InChI=1S/C19H24N2O3S/c1-6-7-8-23-17-9-13(2)18(14(3)10-17)24-11-16-12-25-19(20-16)15(4)21-22-5/h6-7,9-10,12H,8,11H2,1-5H3/b7-6+,21-15+ |
| InChIKey | DQDZMFYVWNXPJJ-HHGKQRJHSA-N |
| XLogP | 4.66 |
| TPSA | 52.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|