C23H33N3O3 — CID 22962957
(E)-1-[5-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenyl]pentoxy]-1-methylimidazol-4-yl]-N-methoxymethanimine (PubChem CID 22962957) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is (E)-1-[5-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenyl]pentoxy]-1-methylimidazol-4-yl]-N-methoxymethanimine.
| Compound Name | (E)-1-[5-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenyl]pentoxy]-1-methylimidazol-4-yl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 22962957 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | (E)-1-[5-[5-[4-[(E)-but-2-enoxy]-2,6-dimethylphenyl]pentoxy]-1-methylimidazol-4-yl]-N-methoxymethanimine |
| SMILES | C/C=C/COc1cc(C)c(CCCCCOc2c(/C=N/OC)ncn2C)c(C)c1 |
| InChI | InChI=1S/C23H33N3O3/c1-6-7-12-28-20-14-18(2)21(19(3)15-20)11-9-8-10-13-29-23-22(16-25-27-5)24-17-26(23)4/h6-7,14-17H,8-13H2,1-5H3/b7-6+,25-16+ |
| InChIKey | WKFGDQOFXZVTKY-ZPWLBNCLSA-N |
| XLogP | 4.76 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|