C24H35N3O3 — CID 22962970
(E)-1-[3-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenyl]hexoxy]-1-methylpyrazol-5-yl]-N-methoxymethanimine (PubChem CID 22962970) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is (E)-1-[3-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenyl]hexoxy]-1-methylpyrazol-5-yl]-N-methoxymethanimine.
| Compound Name | (E)-1-[3-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenyl]hexoxy]-1-methylpyrazol-5-yl]-N-methoxymethanimine |
|---|---|
| PubChem CID | 22962970 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | (E)-1-[3-[6-[4-[(E)-but-2-enoxy]-2,6-dimethylphenyl]hexoxy]-1-methylpyrazol-5-yl]-N-methoxymethanimine |
| SMILES | C/C=C/COc1cc(C)c(CCCCCCOc2cc(/C=N/OC)n(C)n2)c(C)c1 |
| InChI | InChI=1S/C24H35N3O3/c1-6-7-13-29-22-15-19(2)23(20(3)16-22)12-10-8-9-11-14-30-24-17-21(18-25-28-5)27(4)26-24/h6-7,15-18H,8-14H2,1-5H3/b7-6+,25-18+ |
| InChIKey | FYEKSBUCUHRBAL-MAIARSTMSA-N |
| XLogP | 5.15 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|