C19H27ClFNO3 — CID 22963602
N-[3-[4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-2,6-diethylphenoxy]propoxy]propan-2-imine (PubChem CID 22963602) has the molecular formula C19H27ClFNO3 and a molecular weight of 371.88 g/mol. Its IUPAC name is N-[3-[4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-2,6-diethylphenoxy]propoxy]propan-2-imine.
| Compound Name | N-[3-[4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-2,6-diethylphenoxy]propoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963602 |
| Molecular Formula | C19H27ClFNO3 |
| Molecular Weight | 371.88 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[3-[4-[(E)-3-chloro-3-fluoroprop-2-enoxy]-2,6-diethylphenoxy]propoxy]propan-2-imine |
| SMILES | CCc1cc(OC/C=C(\F)Cl)cc(CC)c1OCCCON=C(C)C |
| InChI | InChI=1S/C19H27ClFNO3/c1-5-15-12-17(23-11-8-18(20)21)13-16(6-2)19(15)24-9-7-10-25-22-14(3)4/h8,12-13H,5-7,9-11H2,1-4H3/b18-8- |
| InChIKey | HTCSKLAWFGJALY-LSCVHKIXSA-N |
| XLogP | 5.42 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.88 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|