C20H29F2NO3 — CID 22963848
N-[5-[4-(3,3-difluoroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentoxy]propan-2-imine (PubChem CID 22963848) has the molecular formula C20H29F2NO3 and a molecular weight of 369.45 g/mol. Its IUPAC name is N-[5-[4-(3,3-difluoroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentoxy]propan-2-imine.
| Compound Name | N-[5-[4-(3,3-difluoroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentoxy]propan-2-imine |
|---|---|
| PubChem CID | 22963848 |
| Molecular Formula | C20H29F2NO3 |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[5-[4-(3,3-difluoroprop-2-enoxy)-2-ethyl-6-methylphenoxy]pentoxy]propan-2-imine |
| SMILES | CCc1cc(OCC=C(F)F)cc(C)c1OCCCCCON=C(C)C |
| InChI | InChI=1S/C20H29F2NO3/c1-5-17-14-18(24-12-9-19(21)22)13-16(4)20(17)25-10-7-6-8-11-26-23-15(2)3/h9,13-14H,5-8,10-12H2,1-4H3 |
| InChIKey | BSCHKRRVGYMVOF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|