About N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine
N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine (PubChem CID 22964143) has the molecular formula C5H3F6N
and a molecular weight of 191.07 g/mol. Its IUPAC name is N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine.
Molecular Properties
| Compound Name | N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine |
| PubChem CID | 22964143 |
| Molecular Formula | C5H3F6N |
| Molecular Weight | 191.07 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine |
| SMILES | C=NC=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H3F6N/c1-12-2-3(4(6,7)8)5(9,10)11/h2H,1H2 |
| InChIKey | KTBWPYQHOVMNDQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.07 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine?
The IUPAC name of N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine (CID 22964143) is N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine.
What is the SMILES notation for N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine?
The canonical SMILES for N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine is C=NC=C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine?
The InChIKey is KTBWPYQHOVMNDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F6N/c1-12-2-3(4(6,7)8)5(9,10)11/h2H,1H2.
What are the key properties of N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine?
N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine has a molecular weight of 191.07 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,3,3-trifluoro-2-(trifluoromethyl)prop-1-enyl]methanimine is sourced from PubChem (CID 22964143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).