C11H13N — CID 22965486
2,4-dimethyl-6H-isoquinoline (PubChem CID 22965486) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 2,4-dimethyl-6H-isoquinoline.
| Compound Name | 2,4-dimethyl-6H-isoquinoline |
|---|---|
| PubChem CID | 22965486 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2,4-dimethyl-6H-isoquinoline |
| SMILES | CC1=CN(C)C=C2C=CCC=C12 |
| InChI | InChI=1S/C11H13N/c1-9-7-12(2)8-10-5-3-4-6-11(9)10/h3,5-8H,4H2,1-2H3 |
| InChIKey | WQOGEUZBYCMVIO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |