C13H19N — CID 134944969
(E)-6-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylhex-1-en-1-amine (PubChem CID 134944969) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (E)-6-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylhex-1-en-1-amine.
| Compound Name | (E)-6-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylhex-1-en-1-amine |
|---|---|
| PubChem CID | 134944969 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (E)-6-cyclopenta-2,4-dien-1-ylidene-N,N-dimethylhex-1-en-1-amine |
| SMILES | CN(C)/C=C/CCCC=C1C=CC=C1 |
| InChI | InChI=1S/C13H19N/c1-14(2)12-8-4-3-5-9-13-10-6-7-11-13/h6-12H,3-5H2,1-2H3/b12-8+ |
| InChIKey | LBVUGEYVNWWWLW-XYOKQWHBSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|