C17H25N — CID 13204017
(1E,3E)-8-cyclopenta-2,4-dien-1-ylidene-N,N-diethylocta-1,3-dien-1-amine (PubChem CID 13204017) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (1E,3E)-8-cyclopenta-2,4-dien-1-ylidene-N,N-diethylocta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-8-cyclopenta-2,4-dien-1-ylidene-N,N-diethylocta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 13204017 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (1E,3E)-8-cyclopenta-2,4-dien-1-ylidene-N,N-diethylocta-1,3-dien-1-amine |
| SMILES | CCN(/C=C/C=C/CCCC=C1C=CC=C1)CC |
| InChI | InChI=1S/C17H25N/c1-3-18(4-2)16-12-8-6-5-7-9-13-17-14-10-11-15-17/h6,8,10-16H,3-5,7,9H2,1-2H3/b8-6+,16-12+ |
| InChIKey | XCZVYCIGGZHNBG-YUDPATCQSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|