About N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine
N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine (PubChem CID 12618097) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine.
Molecular Properties
| Compound Name | N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine |
| PubChem CID | 12618097 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine |
| SMILES | CCN(C=C1C=CC=C1)CC |
| InChI | InChI=1S/C10H15N/c1-3-11(4-2)9-10-7-5-6-8-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | JZMNFQDAZRPTGB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine?
The IUPAC name of N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine (CID 12618097) is N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine.
What is the SMILES notation for N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine?
The canonical SMILES for N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine is CCN(C=C1C=CC=C1)CC.
What is the InChIKey of N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine?
The InChIKey is JZMNFQDAZRPTGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-3-11(4-2)9-10-7-5-6-8-10/h5-9H,3-4H2,1-2H3.
What are the key properties of N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine?
N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine has a molecular weight of 149.24 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopenta-2,4-dien-1-ylidenemethyl)-N-ethylethanamine is sourced from PubChem (CID 12618097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).