C18H27N — CID 13204019
(1E,3E)-8-cyclopenta-2,4-dien-1-ylidene-N,N-diethylnona-1,3-dien-1-amine (PubChem CID 13204019) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is (1E,3E)-8-cyclopenta-2,4-dien-1-ylidene-N,N-diethylnona-1,3-dien-1-amine.
| Compound Name | (1E,3E)-8-cyclopenta-2,4-dien-1-ylidene-N,N-diethylnona-1,3-dien-1-amine |
|---|---|
| PubChem CID | 13204019 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | (1E,3E)-8-cyclopenta-2,4-dien-1-ylidene-N,N-diethylnona-1,3-dien-1-amine |
| SMILES | CCN(/C=C/C=C/CCCC(C)=C1C=CC=C1)CC |
| InChI | InChI=1S/C18H27N/c1-4-19(5-2)16-12-8-6-7-9-13-17(3)18-14-10-11-15-18/h6,8,10-12,14-16H,4-5,7,9,13H2,1-3H3/b8-6+,16-12+ |
| InChIKey | AEJYUZHRFVTUGQ-YUDPATCQSA-N |
| XLogP | 5.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|