C16H18NO2+ — CID 22965611
[4-[[(4-methoxyphenyl)methylamino]methyl]phenyl]-methylideneoxidanium (PubChem CID 22965611) has the molecular formula C16H18NO2+ and a molecular weight of 256.32 g/mol. Its IUPAC name is [4-[[(4-methoxyphenyl)methylamino]methyl]phenyl]-methylideneoxidanium.
| Compound Name | [4-[[(4-methoxyphenyl)methylamino]methyl]phenyl]-methylideneoxidanium |
|---|---|
| PubChem CID | 22965611 |
| Molecular Formula | C16H18NO2+ |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [4-[[(4-methoxyphenyl)methylamino]methyl]phenyl]-methylideneoxidanium |
| SMILES | C=[O+]c1ccc(CNCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C16H18NO2/c1-18-15-7-3-13(4-8-15)11-17-12-14-5-9-16(19-2)10-6-14/h3-10,17H,1,11-12H2,2H3/q+1 |
| InChIKey | RMNQYUAUYCLFKF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|