C23H26N2O — CID 22965921
6-ethenyl-15-methoxy-13-methyl-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 22965921) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 6-ethenyl-15-methoxy-13-methyl-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 6-ethenyl-15-methoxy-13-methyl-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 22965921 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 6-ethenyl-15-methoxy-13-methyl-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | C=Cc1cnc2c(c1)CCc1cc(C)cc(OC)c1C2=C1CCNCC1 |
| InChI | InChI=1S/C23H26N2O/c1-4-16-13-19-6-5-18-11-15(2)12-20(26-3)21(18)22(23(19)25-14-16)17-7-9-24-10-8-17/h4,11-14,24H,1,5-10H2,2-3H3 |
| InChIKey | PKWHWAUTLLIZNL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |