C16H13F3NO+ — CID 22968445
8-methyl-3-[4-(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium (PubChem CID 22968445) has the molecular formula C16H13F3NO+ and a molecular weight of 292.28 g/mol. Its IUPAC name is 8-methyl-3-[4-(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium.
| Compound Name | 8-methyl-3-[4-(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 22968445 |
| Molecular Formula | C16H13F3NO+ |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 8-methyl-3-[4-(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium |
| SMILES | Cc1cccc2c1OC[N+](c1ccc(C(F)(F)F)cc1)=C2 |
| InChI | InChI=1S/C16H13F3NO/c1-11-3-2-4-12-9-20(10-21-15(11)12)14-7-5-13(6-8-14)16(17,18)19/h2-9H,10H2,1H3/q+1 |
| InChIKey | IXUVWRSGPCZPAB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|