C34H33F3N4OSi — CID 22969397
1,1-diphenyl-N-[5-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]methanimine (PubChem CID 22969397) has the molecular formula C34H33F3N4OSi and a molecular weight of 598.75 g/mol. Its IUPAC name is 1,1-diphenyl-N-[5-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]methanimine.
| Compound Name | 1,1-diphenyl-N-[5-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]methanimine |
|---|---|
| PubChem CID | 22969397 |
| Molecular Formula | C34H33F3N4OSi |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 1,1-diphenyl-N-[5-[4-[3-(trifluoromethyl)phenyl]-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3-pyridinyl]methanimine |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cccc(C(F)(F)F)c2)nc1-c1cncc(N=C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C34H33F3N4OSi/c1-43(2,3)18-17-42-24-41-23-31(27-15-10-16-29(19-27)34(35,36)37)40-33(41)28-20-30(22-38-21-28)39-32(25-11-6-4-7-12-25)26-13-8-5-9-14-26/h4-16,19-23H,17-18,24H2,1-3H3 |
| InChIKey | ACFYFMIOYCVISU-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|