C21H23BrF3N3OSi — CID 22969438
2-[[2-(5-bromo-3-pyridinyl)-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 22969438) has the molecular formula C21H23BrF3N3OSi and a molecular weight of 498.42 g/mol. Its IUPAC name is 2-[[2-(5-bromo-3-pyridinyl)-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(5-bromo-3-pyridinyl)-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 22969438 |
| Molecular Formula | C21H23BrF3N3OSi |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 2-[[2-(5-bromo-3-pyridinyl)-4-[3-(trifluoromethyl)phenyl]imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cccc(C(F)(F)F)c2)nc1-c1cncc(Br)c1 |
| InChI | InChI=1S/C21H23BrF3N3OSi/c1-30(2,3)8-7-29-14-28-13-19(15-5-4-6-17(9-15)21(23,24)25)27-20(28)16-10-18(22)12-26-11-16/h4-6,9-13H,7-8,14H2,1-3H3 |
| InChIKey | VWGCPHRPTVGTJP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|