C25H33FN4OSi — CID 22969444
2-[[4-(3-fluorophenyl)-2-(1-pyridin-2-ylpiperidin-4-yl)imidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 22969444) has the molecular formula C25H33FN4OSi and a molecular weight of 452.65 g/mol. Its IUPAC name is 2-[[4-(3-fluorophenyl)-2-(1-pyridin-2-ylpiperidin-4-yl)imidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-(3-fluorophenyl)-2-(1-pyridin-2-ylpiperidin-4-yl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 22969444 |
| Molecular Formula | C25H33FN4OSi |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 2-[[4-(3-fluorophenyl)-2-(1-pyridin-2-ylpiperidin-4-yl)imidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2cccc(F)c2)nc1C1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C25H33FN4OSi/c1-32(2,3)16-15-31-19-30-18-23(21-7-6-8-22(26)17-21)28-25(30)20-10-13-29(14-11-20)24-9-4-5-12-27-24/h4-9,12,17-18,20H,10-11,13-16,19H2,1-3H3 |
| InChIKey | OIZYFNAYFYSALF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|