C18H32N2O — CID 22970189
3-N-(4-methoxycyclohexyl)-2-N-(4-methylcyclohexyl)butane-2,3-diimine (PubChem CID 22970189) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is 3-N-(4-methoxycyclohexyl)-2-N-(4-methylcyclohexyl)butane-2,3-diimine.
| Compound Name | 3-N-(4-methoxycyclohexyl)-2-N-(4-methylcyclohexyl)butane-2,3-diimine |
|---|---|
| PubChem CID | 22970189 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 3-N-(4-methoxycyclohexyl)-2-N-(4-methylcyclohexyl)butane-2,3-diimine |
| SMILES | COC1CCC(/N=C(C)/C(C)=N/C2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C18H32N2O/c1-13-5-7-16(8-6-13)19-14(2)15(3)20-17-9-11-18(21-4)12-10-17/h13,16-18H,5-12H2,1-4H3/b19-14+,20-15+ |
| InChIKey | WHOVVXVZYGDQML-PXXPDPNMSA-N |
| XLogP | 4.44 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|