About N-(bromomethyl)acetamide
N-(bromomethyl)acetamide (PubChem CID 22970413) has the molecular formula C3H6BrNO
and a molecular weight of 151.99 g/mol. Its IUPAC name is N-(bromomethyl)acetamide.
Molecular Properties
| Compound Name | N-(bromomethyl)acetamide |
| PubChem CID | 22970413 |
| Molecular Formula | C3H6BrNO |
| Molecular Weight | 151.99 g/mol |
| Exact Mass | 150.96 |
| IUPAC Name | N-(bromomethyl)acetamide |
| SMILES | CC(=O)NCBr |
| InChI | InChI=1S/C3H6BrNO/c1-3(6)5-2-4/h2H2,1H3,(H,5,6) |
| InChIKey | JSZJAUWFAFGOET-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.99 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(bromomethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(bromomethyl)acetamide?
The IUPAC name of N-(bromomethyl)acetamide (CID 22970413) is N-(bromomethyl)acetamide.
What is the SMILES notation for N-(bromomethyl)acetamide?
The canonical SMILES for N-(bromomethyl)acetamide is CC(=O)NCBr.
What is the InChIKey of N-(bromomethyl)acetamide?
The InChIKey is JSZJAUWFAFGOET-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BrNO/c1-3(6)5-2-4/h2H2,1H3,(H,5,6).
What are the key properties of N-(bromomethyl)acetamide?
N-(bromomethyl)acetamide has a molecular weight of 151.99 g/mol, XLogP of 0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(bromomethyl)acetamide is sourced from PubChem (CID 22970413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).