C20H36N2O2 — CID 22972617
N'-tert-butyl-2-(2-cyclopentylethyl)-3-[(2-methylcyclopropyl)methyl]butanediamide (PubChem CID 22972617) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is N'-tert-butyl-2-(2-cyclopentylethyl)-3-[(2-methylcyclopropyl)methyl]butanediamide.
| Compound Name | N'-tert-butyl-2-(2-cyclopentylethyl)-3-[(2-methylcyclopropyl)methyl]butanediamide |
|---|---|
| PubChem CID | 22972617 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | N'-tert-butyl-2-(2-cyclopentylethyl)-3-[(2-methylcyclopropyl)methyl]butanediamide |
| SMILES | CC1CC1CC(C(=O)NC(C)(C)C)C(CCC1CCCC1)C(N)=O |
| InChI | InChI=1S/C20H36N2O2/c1-13-11-15(13)12-17(19(24)22-20(2,3)4)16(18(21)23)10-9-14-7-5-6-8-14/h13-17H,5-12H2,1-4H3,(H2,21,23)(H,22,24) |
| InChIKey | DVXMNVOGIOXLEE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |