C23H26ClN3O3 — CID 22972874
[5-[[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-chlorophenyl]methanol (PubChem CID 22972874) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is [5-[[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-chlorophenyl]methanol.
| Compound Name | [5-[[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-chlorophenyl]methanol |
|---|---|
| PubChem CID | 22972874 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | [5-[[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-chlorophenyl]methanol |
| SMILES | OCc1cc(OC[C@H]2CC[C@H]3CN(c4noc5ccccc45)CCN3C2)ccc1Cl |
| InChI | InChI=1S/C23H26ClN3O3/c24-21-8-7-19(11-17(21)14-28)29-15-16-5-6-18-13-27(10-9-26(18)12-16)23-20-3-1-2-4-22(20)30-25-23/h1-4,7-8,11,16,18,28H,5-6,9-10,12-15H2/t16-,18-/m0/s1 |
| InChIKey | SAWFVHGGBQKVOG-WMZOPIPTSA-N |
| XLogP | 3.95 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |