C17H24N4O — CID 11130376
2-[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]ethanamine (PubChem CID 11130376) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]ethanamine.
| Compound Name | 2-[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]ethanamine |
|---|---|
| PubChem CID | 11130376 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-[(7S,9aS)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]ethanamine |
| SMILES | NCC[C@@H]1CC[C@H]2CN(c3noc4ccccc34)CCN2C1 |
| InChI | InChI=1S/C17H24N4O/c18-8-7-13-5-6-14-12-21(10-9-20(14)11-13)17-15-3-1-2-4-16(15)22-19-17/h1-4,13-14H,5-12,18H2/t13-,14-/m0/s1 |
| InChIKey | JKXRUQHARAWHTR-KBPBESRZSA-N |
| XLogP | 2.08 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |