C19H27N3O4S — CID 57101327
3-[(7S,9aR)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]propyl methanesulfonate (PubChem CID 57101327) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is 3-[(7S,9aR)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]propyl methanesulfonate.
| Compound Name | 3-[(7S,9aR)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 57101327 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-[(7S,9aR)-2-(1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]propyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCC[C@@H]1CC[C@@H]2CN(c3noc4ccccc34)CCN2C1 |
| InChI | InChI=1S/C19H27N3O4S/c1-27(23,24)25-12-4-5-15-8-9-16-14-22(11-10-21(16)13-15)19-17-6-2-3-7-18(17)26-20-19/h2-3,6-7,15-16H,4-5,8-14H2,1H3/t15-,16-/m1/s1 |
| InChIKey | FOSDYUKYPDYCJF-HZPDHXFCSA-N |
| XLogP | 2.48 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|