C20H29NO4 — CID 22973680
hexyl 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)benzoate (PubChem CID 22973680) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is hexyl 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)benzoate.
| Compound Name | hexyl 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)benzoate |
|---|---|
| PubChem CID | 22973680 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | hexyl 4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)benzoate |
| SMILES | CCCCCCOC(=O)c1ccc(N2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C20H29NO4/c1-2-3-4-5-14-23-19(22)17-6-8-18(9-7-17)21-12-10-20(11-13-21)24-15-16-25-20/h6-9H,2-5,10-16H2,1H3 |
| InChIKey | LUPYVKRJLIZRPJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|