C31H20F2N2O5 — CID 22974094
5-[difluoro-[2-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindol-5-yl]methyl]-2-methylisoindole-1,3-dione (PubChem CID 22974094) has the molecular formula C31H20F2N2O5 and a molecular weight of 538.51 g/mol. Its IUPAC name is 5-[difluoro-[2-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindol-5-yl]methyl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[difluoro-[2-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindol-5-yl]methyl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 22974094 |
| Molecular Formula | C31H20F2N2O5 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | 5-[difluoro-[2-[4-(4-methylphenoxy)phenyl]-1,3-dioxoisoindol-5-yl]methyl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)c4ccc(C(F)(F)c5ccc6c(c5)C(=O)N(C)C6=O)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C31H20F2N2O5/c1-17-3-9-21(10-4-17)40-22-11-7-20(8-12-22)35-29(38)24-14-6-19(16-26(24)30(35)39)31(32,33)18-5-13-23-25(15-18)28(37)34(2)27(23)36/h3-16H,1-2H3 |
| InChIKey | ZJUKPIDPXJLSDW-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|