C23H18N2O4 — CID 1327502
N-(4-ethoxyphenyl)-1,3-dioxo-2-phenylisoindole-5-carboxamide (PubChem CID 1327502) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-1,3-dioxo-2-phenylisoindole-5-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-1,3-dioxo-2-phenylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 1327502 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-(4-ethoxyphenyl)-1,3-dioxo-2-phenylisoindole-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2)C3=O)cc1 |
| InChI | InChI=1S/C23H18N2O4/c1-2-29-18-11-9-16(10-12-18)24-21(26)15-8-13-19-20(14-15)23(28)25(22(19)27)17-6-4-3-5-7-17/h3-14H,2H2,1H3,(H,24,26) |
| InChIKey | BRYVVQRZFJXLGF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|