C31H33FN4O4 — CID 10506729
2-(3-fluorophenyl)-1,3-dioxo-N-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]isoindole-5-carboxamide (PubChem CID 10506729) has the molecular formula C31H33FN4O4 and a molecular weight of 544.63 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1,3-dioxo-N-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]isoindole-5-carboxamide.
| Compound Name | 2-(3-fluorophenyl)-1,3-dioxo-N-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 10506729 |
| Molecular Formula | C31H33FN4O4 |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 2-(3-fluorophenyl)-1,3-dioxo-N-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]isoindole-5-carboxamide |
| SMILES | CC(C)Oc1ccccc1N1CCN(CCCNC(=O)c2ccc3c(c2)C(=O)N(c2cccc(F)c2)C3=O)CC1 |
| InChI | InChI=1S/C31H33FN4O4/c1-21(2)40-28-10-4-3-9-27(28)35-17-15-34(16-18-35)14-6-13-33-29(37)22-11-12-25-26(19-22)31(39)36(30(25)38)24-8-5-7-23(32)20-24/h3-5,7-12,19-21H,6,13-18H2,1-2H3,(H,33,37) |
| InChIKey | WALJAWMIJWFJHE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|